C25H20F3N5O2 — CID 157037163
N-(2-hydroxy-1-phenylethyl)-4-methyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaene-11-carboxamide (PubChem CID 157037163) has the molecular formula C25H20F3N5O2 and a molecular weight of 479.46 g/mol. Its IUPAC name is N-(2-hydroxy-1-phenylethyl)-4-methyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaene-11-carboxamide.
| Compound Name | N-(2-hydroxy-1-phenylethyl)-4-methyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaene-11-carboxamide |
|---|---|
| PubChem CID | 157037163 |
| Molecular Formula | C25H20F3N5O2 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-(2-hydroxy-1-phenylethyl)-4-methyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaene-11-carboxamide |
| SMILES | Cn1cc2c3nc(C(=O)NC(CO)c4ccccc4)ccc3n(-c3ccc(C(F)(F)F)cc3)c2n1 |
| InChI | InChI=1S/C25H20F3N5O2/c1-32-13-18-22-21(33(23(18)31-32)17-9-7-16(8-10-17)25(26,27)28)12-11-19(29-22)24(35)30-20(14-34)15-5-3-2-4-6-15/h2-13,20,34H,14H2,1H3,(H,30,35) |
| InChIKey | WXJJZOZLDKEYTQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |