C15H27NO3 — CID 157039471
(3S,6R)-1-[(Z,3Z)-3-ethylidenehept-4-enyl]-6-(hydroxymethyl)piperidine-3,4-diol (PubChem CID 157039471) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is (3S,6R)-1-[(Z,3Z)-3-ethylidenehept-4-enyl]-6-(hydroxymethyl)piperidine-3,4-diol.
| Compound Name | (3S,6R)-1-[(Z,3Z)-3-ethylidenehept-4-enyl]-6-(hydroxymethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 157039471 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (3S,6R)-1-[(Z,3Z)-3-ethylidenehept-4-enyl]-6-(hydroxymethyl)piperidine-3,4-diol |
| SMILES | C/C=C(\C=C/CC)CCN1C[C@H](O)C(O)C[C@@H]1CO |
| InChI | InChI=1S/C15H27NO3/c1-3-5-6-12(4-2)7-8-16-10-15(19)14(18)9-13(16)11-17/h4-6,13-15,17-19H,3,7-11H2,1-2H3/b6-5-,12-4+/t13-,14?,15+/m1/s1 |
| InChIKey | JEPGPIJYUUSKNV-ORZUABSJSA-N |
| XLogP | 1.08 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|