C12H21NO4 — CID 139598074
(3R,4R,5S)-1-[(2E,4E)-hexa-2,4-dienyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 139598074) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is (3R,4R,5S)-1-[(2E,4E)-hexa-2,4-dienyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (3R,4R,5S)-1-[(2E,4E)-hexa-2,4-dienyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 139598074 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | (3R,4R,5S)-1-[(2E,4E)-hexa-2,4-dienyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | C/C=C/C=C/CN1C[C@H](O)[C@@H](O)[C@H](O)C1CO |
| InChI | InChI=1S/C12H21NO4/c1-2-3-4-5-6-13-7-10(15)12(17)11(16)9(13)8-14/h2-5,9-12,14-17H,6-8H2,1H3/b3-2+,5-4+/t9?,10-,11+,12+/m0/s1 |
| InChIKey | YRFCEEWIXYBDJU-RWPQLMKOSA-N |
| XLogP | -1.12 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|