C15H25NO3 — CID 157039699
(3S,6R)-1-[(4Z)-4-ethenylhepta-4,6-dienyl]-6-(hydroxymethyl)piperidine-3,4-diol (PubChem CID 157039699) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (3S,6R)-1-[(4Z)-4-ethenylhepta-4,6-dienyl]-6-(hydroxymethyl)piperidine-3,4-diol.
| Compound Name | (3S,6R)-1-[(4Z)-4-ethenylhepta-4,6-dienyl]-6-(hydroxymethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 157039699 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (3S,6R)-1-[(4Z)-4-ethenylhepta-4,6-dienyl]-6-(hydroxymethyl)piperidine-3,4-diol |
| SMILES | C=C/C=C(\C=C)CCCN1C[C@H](O)C(O)C[C@@H]1CO |
| InChI | InChI=1S/C15H25NO3/c1-3-6-12(4-2)7-5-8-16-10-15(19)14(18)9-13(16)11-17/h3-4,6,13-15,17-19H,1-2,5,7-11H2/b12-6+/t13-,14?,15+/m1/s1 |
| InChIKey | WNLJWJNXJDSXEE-ZZZNCJATSA-N |
| XLogP | 0.85 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|