C17H25F2NO4 — CID 157039772
(2R,3R,4R,5S)-1-[2-(2,6-difluoro-4-propan-2-ylphenyl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 157039772) has the molecular formula C17H25F2NO4 and a molecular weight of 345.39 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[2-(2,6-difluoro-4-propan-2-ylphenyl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[2-(2,6-difluoro-4-propan-2-ylphenyl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157039772 |
| Molecular Formula | C17H25F2NO4 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (2R,3R,4R,5S)-1-[2-(2,6-difluoro-4-propan-2-ylphenyl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | CC(C)c1cc(F)c(CCN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)c(F)c1 |
| InChI | InChI=1S/C17H25F2NO4/c1-9(2)10-5-12(18)11(13(19)6-10)3-4-20-7-15(22)17(24)16(23)14(20)8-21/h5-6,9,14-17,21-24H,3-4,7-8H2,1-2H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | YEKUTNGDOVMSBC-YYIAUSFCSA-N |
| XLogP | 0.39 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |