C17H25N3O2 — CID 157043155
O-[6-(2,6-dimethylmorpholin-4-yl)quinolin-4-yl]hydroxylamine;ethane (PubChem CID 157043155) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is O-[6-(2,6-dimethylmorpholin-4-yl)quinolin-4-yl]hydroxylamine;ethane.
| Compound Name | O-[6-(2,6-dimethylmorpholin-4-yl)quinolin-4-yl]hydroxylamine;ethane |
|---|---|
| PubChem CID | 157043155 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | O-[6-(2,6-dimethylmorpholin-4-yl)quinolin-4-yl]hydroxylamine;ethane |
| SMILES | CC.CC1CN(c2ccc3nccc(ON)c3c2)CC(C)O1 |
| InChI | InChI=1S/C15H19N3O2.C2H6/c1-10-8-18(9-11(2)19-10)12-3-4-14-13(7-12)15(20-16)5-6-17-14;1-2/h3-7,10-11H,8-9,16H2,1-2H3;1-2H3 |
| InChIKey | IBTMKBQONOVNFM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|