C20H32N2O2 — CID 157043902
ethane;4-(4-methoxyquinolin-6-yl)-2,6-dimethylmorpholine (PubChem CID 157043902) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is ethane;4-(4-methoxyquinolin-6-yl)-2,6-dimethylmorpholine.
| Compound Name | ethane;4-(4-methoxyquinolin-6-yl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 157043902 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | ethane;4-(4-methoxyquinolin-6-yl)-2,6-dimethylmorpholine |
| SMILES | CC.CC.COc1ccnc2ccc(N3CC(C)OC(C)C3)cc12 |
| InChI | InChI=1S/C16H20N2O2.2C2H6/c1-11-9-18(10-12(2)20-11)13-4-5-15-14(8-13)16(19-3)6-7-17-15;2*1-2/h4-8,11-12H,9-10H2,1-3H3;2*1-2H3 |
| InChIKey | PDNGLLCLQNSVIN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |