C11H14BrNOZn — CID 157045422
bromozinc(1+);2-methyl-4-(3,4,5,6-tetrahydro-2H-pyran-4-id-2-yl)pyridine (PubChem CID 157045422) has the molecular formula C11H14BrNOZn and a molecular weight of 321.53 g/mol. Its IUPAC name is bromozinc(1+);2-methyl-4-(3,4,5,6-tetrahydro-2H-pyran-4-id-2-yl)pyridine.
| Compound Name | bromozinc(1+);2-methyl-4-(3,4,5,6-tetrahydro-2H-pyran-4-id-2-yl)pyridine |
|---|---|
| PubChem CID | 157045422 |
| Molecular Formula | C11H14BrNOZn |
| Molecular Weight | 321.53 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | bromozinc(1+);2-methyl-4-(3,4,5,6-tetrahydro-2H-pyran-4-id-2-yl)pyridine |
| SMILES | Cc1cc(C2C[CH-]CCO2)ccn1.[Zn+]Br |
| InChI | InChI=1S/C11H14NO.BrH.Zn/c1-9-8-10(5-6-12-9)11-4-2-3-7-13-11;;/h2,5-6,8,11H,3-4,7H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | NDJGIOBGIZFQGP-UHFFFAOYSA-M |
| XLogP | 3.29 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|