C9H11N3OS — CID 157046693
N-hydroxysulfanyl-1-imidazo[1,2-a]pyridin-6-ylethanamine (PubChem CID 157046693) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is N-hydroxysulfanyl-1-imidazo[1,2-a]pyridin-6-ylethanamine.
| Compound Name | N-hydroxysulfanyl-1-imidazo[1,2-a]pyridin-6-ylethanamine |
|---|---|
| PubChem CID | 157046693 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | N-hydroxysulfanyl-1-imidazo[1,2-a]pyridin-6-ylethanamine |
| SMILES | CC(NSO)c1ccc2nccn2c1 |
| InChI | InChI=1S/C9H11N3OS/c1-7(11-14-13)8-2-3-9-10-4-5-12(9)6-8/h2-7,11,13H,1H3 |
| InChIKey | SIYBZINBEZQMOF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|