About ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane
ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane (PubChem CID 157048914) has the molecular formula C11H20N4O5
and a molecular weight of 288.30 g/mol. Its IUPAC name is ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane.
Molecular Properties
| Compound Name | ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane |
| PubChem CID | 157048914 |
| Molecular Formula | C11H20N4O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane |
| SMILES | C.CCOC(=O)O[C@H](C)n1nnc(COCC(C)=O)n1 |
| InChI | InChI=1S/C10H16N4O5.CH4/c1-4-18-10(16)19-8(3)14-12-9(11-13-14)6-17-5-7(2)15;/h8H,4-6H2,1-3H3;1H4/t8-;/m1./s1 |
| InChIKey | RSJKCQZIVSEIRC-DDWIOCJRSA-N |
| XLogP | 1.11 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane?
The IUPAC name of ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane (CID 157048914) is ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane.
What is the SMILES notation for ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane?
The canonical SMILES for ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane is C.CCOC(=O)O[C@H](C)n1nnc(COCC(C)=O)n1.
What is the InChIKey of ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane?
The InChIKey is RSJKCQZIVSEIRC-DDWIOCJRSA-N. The full InChI is InChI=1S/C10H16N4O5.CH4/c1-4-18-10(16)19-8(3)14-12-9(11-13-14)6-17-5-7(2)15;/h8H,4-6H2,1-3H3;1H4/t8-;/m1./s1.
What are the key properties of ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane?
ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane has a molecular weight of 288.30 g/mol, XLogP of 1.11, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] carbonate;methane is sourced from PubChem (CID 157048914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).