[(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate

C8H12N4O5 — CID 175898312

IUPAC[(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate
SMILESCC(=O)COCc1nnn([C@@H](C)OC(=O)O)n1
InChIInChI=1S/C8H12N4O5/c1-5(13)3-16-4-7-9-11-12(10-7)6(2)17-8(14)15/h6H,3-4H2,1-2H3,(H,14,15)/t6-/m1/s1
InChIKeySZJHHZQCEHSGAM-ZCFIWIBFSA-N
MW244.21 g/mol
LogP-0.01
Rot. Bonds6

About [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate

[(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate (PubChem CID 175898312) has the molecular formula C8H12N4O5 and a molecular weight of 244.21 g/mol. Its IUPAC name is [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate.

Molecular Properties

Compound Name[(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate
PubChem CID175898312
Molecular FormulaC8H12N4O5
Molecular Weight244.21 g/mol
Exact Mass244.08
IUPAC Name[(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate
SMILESCC(=O)COCc1nnn([C@@H](C)OC(=O)O)n1
InChIInChI=1S/C8H12N4O5/c1-5(13)3-16-4-7-9-11-12(10-7)6(2)17-8(14)15/h6H,3-4H2,1-2H3,(H,14,15)/t6-/m1/s1
InChIKeySZJHHZQCEHSGAM-ZCFIWIBFSA-N
XLogP-0.01
TPSA116.43 Ų
H-Bond Donors1
H-Bond Acceptors8
Rotatable Bonds6
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.21
LogP ≤ 5-0.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 108

Analyze [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate?
The IUPAC name of [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate (CID 175898312) is [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate.
What is the SMILES notation for [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate?
The canonical SMILES for [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate is CC(=O)COCc1nnn([C@@H](C)OC(=O)O)n1.
What is the InChIKey of [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate?
The InChIKey is SZJHHZQCEHSGAM-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H12N4O5/c1-5(13)3-16-4-7-9-11-12(10-7)6(2)17-8(14)15/h6H,3-4H2,1-2H3,(H,14,15)/t6-/m1/s1.
What are the key properties of [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate?
[(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate has a molecular weight of 244.21 g/mol, XLogP of -0.01, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl] hydrogen carbonate is sourced from PubChem (CID 175898312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).