About ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate
ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate (PubChem CID 157048952) has the molecular formula C11H18N4O5
and a molecular weight of 286.29 g/mol. Its IUPAC name is ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate.
Molecular Properties
| Compound Name | ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate |
| PubChem CID | 157048952 |
| Molecular Formula | C11H18N4O5 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate |
| SMILES | C=C.CCOC(=O)OCn1nnc(COCC(C)=O)n1 |
| InChI | InChI=1S/C9H14N4O5.C2H4/c1-3-17-9(15)18-6-13-11-8(10-12-13)5-16-4-7(2)14;1-2/h3-6H2,1-2H3;1-2H2 |
| InChIKey | KRQAQUAUPHTWNC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate?
The IUPAC name of ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate (CID 157048952) is ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate.
What is the SMILES notation for ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate?
The canonical SMILES for ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate is C=C.CCOC(=O)OCn1nnc(COCC(C)=O)n1.
What is the InChIKey of ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate?
The InChIKey is KRQAQUAUPHTWNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O5.C2H4/c1-3-17-9(15)18-6-13-11-8(10-12-13)5-16-4-7(2)14;1-2/h3-6H2,1-2H3;1-2H2.
What are the key properties of ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate?
ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate has a molecular weight of 286.29 g/mol, XLogP of 0.71, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;ethyl [5-(2-oxopropoxymethyl)tetrazol-2-yl]methyl carbonate is sourced from PubChem (CID 157048952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).