C8H12N4O5 — CID 175425459
1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl hydrogen carbonate (PubChem CID 175425459) has the molecular formula C8H12N4O5 and a molecular weight of 244.21 g/mol. Its IUPAC name is 1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl hydrogen carbonate.
| Compound Name | 1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl hydrogen carbonate |
|---|---|
| PubChem CID | 175425459 |
| Molecular Formula | C8H12N4O5 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-[5-(2-oxopropoxymethyl)tetrazol-2-yl]ethyl hydrogen carbonate |
| SMILES | CC(=O)COCc1nnn(C(C)OC(=O)O)n1 |
| InChI | InChI=1S/C8H12N4O5/c1-5(13)3-16-4-7-9-11-12(10-7)6(2)17-8(14)15/h6H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | SZJHHZQCEHSGAM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |