About 1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate
1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate (PubChem CID 157051683) has the molecular formula C25H24O9
and a molecular weight of 468.46 g/mol. Its IUPAC name is 1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate.
Molecular Properties
| Compound Name | 1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate |
| PubChem CID | 157051683 |
| Molecular Formula | C25H24O9 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate |
| SMILES | CC(=O)c1ccc2occc2c1.COC(=O)CC(=O)c1ccc2occc2c1.COC(=O)OC |
| InChI | InChI=1S/C12H10O4.C10H8O2.C3H6O3/c1-15-12(14)7-10(13)8-2-3-11-9(6-8)4-5-16-11;1-7(11)8-2-3-10-9(6-8)4-5-12-10;1-5-3(4)6-2/h2-6H,7H2,1H3;2-6H,1H3;1-2H3 |
| InChIKey | AAGYPDLERLUXIG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 122.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate?
The IUPAC name of 1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate (CID 157051683) is 1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate.
What is the SMILES notation for 1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate?
The canonical SMILES for 1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate is CC(=O)c1ccc2occc2c1.COC(=O)CC(=O)c1ccc2occc2c1.COC(=O)OC.
What is the InChIKey of 1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate?
The InChIKey is AAGYPDLERLUXIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O4.C10H8O2.C3H6O3/c1-15-12(14)7-10(13)8-2-3-11-9(6-8)4-5-16-11;1-7(11)8-2-3-10-9(6-8)4-5-12-10;1-5-3(4)6-2/h2-6H,7H2,1H3;2-6H,1H3;1-2H3.
What are the key properties of 1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate?
1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate has a molecular weight of 468.46 g/mol, XLogP of 5.21, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-benzofuran-5-yl)ethanone;dimethyl carbonate;methyl 3-(1-benzofuran-5-yl)-3-oxopropanoate is sourced from PubChem (CID 157051683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).