About 2-iminononane-1,8-diamine
2-iminononane-1,8-diamine (PubChem CID 157053854) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is 2-iminononane-1,8-diamine.
Molecular Properties
| Compound Name | 2-iminononane-1,8-diamine |
| PubChem CID | 157053854 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 2-iminononane-1,8-diamine |
| SMILES | [H]/N=C(\CN)CCCCCC(C)N |
| InChI | InChI=1S/C9H21N3/c1-8(11)5-3-2-4-6-9(12)7-10/h8,12H,2-7,10-11H2,1H3/b12-9- |
| InChIKey | DWNDPKZIVXESHY-XFXZXTDPSA-N |
| XLogP | 1.26 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminononane-1,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminononane-1,8-diamine?
The IUPAC name of 2-iminononane-1,8-diamine (CID 157053854) is 2-iminononane-1,8-diamine.
What is the SMILES notation for 2-iminononane-1,8-diamine?
The canonical SMILES for 2-iminononane-1,8-diamine is [H]/N=C(\CN)CCCCCC(C)N.
What is the InChIKey of 2-iminononane-1,8-diamine?
The InChIKey is DWNDPKZIVXESHY-XFXZXTDPSA-N. The full InChI is InChI=1S/C9H21N3/c1-8(11)5-3-2-4-6-9(12)7-10/h8,12H,2-7,10-11H2,1H3/b12-9-.
What are the key properties of 2-iminononane-1,8-diamine?
2-iminononane-1,8-diamine has a molecular weight of 171.29 g/mol, XLogP of 1.26, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminononane-1,8-diamine is sourced from PubChem (CID 157053854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).