C22H17ClN2O5S2 — CID 157055968
4-amino-2-[4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-4H-isoquinoline-1,3-dione (PubChem CID 157055968) has the molecular formula C22H17ClN2O5S2 and a molecular weight of 488.97 g/mol. Its IUPAC name is 4-amino-2-[4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 4-amino-2-[4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 157055968 |
| Molecular Formula | C22H17ClN2O5S2 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 4-amino-2-[4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-4H-isoquinoline-1,3-dione |
| SMILES | NC1C(=O)N(c2ccc(CC(=O)CS(=O)(=O)c3ccc(Cl)s3)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H17ClN2O5S2/c23-18-9-10-19(31-18)32(29,30)12-15(26)11-13-5-7-14(8-6-13)25-21(27)17-4-2-1-3-16(17)20(24)22(25)28/h1-10,20H,11-12,24H2 |
| InChIKey | KKYVBZHMCAKPPB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|