C34H43N3O8 — CID 157056295
N-[1-(4-acetylphenyl)-3,6-dioxoheptan-2-yl]-2-[(4-acetylphenyl)methyl]-6-[2-[(2-aminoacetyl)amino]ethoxy]-4-oxohexanamide (PubChem CID 157056295) has the molecular formula C34H43N3O8 and a molecular weight of 621.73 g/mol. Its IUPAC name is N-[1-(4-acetylphenyl)-3,6-dioxoheptan-2-yl]-2-[(4-acetylphenyl)methyl]-6-[2-[(2-aminoacetyl)amino]ethoxy]-4-oxohexanamide.
| Compound Name | N-[1-(4-acetylphenyl)-3,6-dioxoheptan-2-yl]-2-[(4-acetylphenyl)methyl]-6-[2-[(2-aminoacetyl)amino]ethoxy]-4-oxohexanamide |
|---|---|
| PubChem CID | 157056295 |
| Molecular Formula | C34H43N3O8 |
| Molecular Weight | 621.73 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | N-[1-(4-acetylphenyl)-3,6-dioxoheptan-2-yl]-2-[(4-acetylphenyl)methyl]-6-[2-[(2-aminoacetyl)amino]ethoxy]-4-oxohexanamide |
| SMILES | CC(=O)CCC(=O)C(Cc1ccc(C(C)=O)cc1)NC(=O)C(CC(=O)CCOCCNC(=O)CN)Cc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C34H43N3O8/c1-22(38)4-13-32(42)31(19-26-7-11-28(12-8-26)24(3)40)37-34(44)29(18-25-5-9-27(10-6-25)23(2)39)20-30(41)14-16-45-17-15-36-33(43)21-35/h5-12,29,31H,4,13-21,35H2,1-3H3,(H,36,43)(H,37,44) |
| InChIKey | VSPUWPMOFUFGGB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 178.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.73 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|