C22H31N3O6 — CID 157056293
2-[(4-acetylphenyl)methyl]-6-[2-[(2-aminoacetyl)amino]ethoxy]-4-oxo-N-(2-oxopropyl)hexanamide (PubChem CID 157056293) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[(4-acetylphenyl)methyl]-6-[2-[(2-aminoacetyl)amino]ethoxy]-4-oxo-N-(2-oxopropyl)hexanamide.
| Compound Name | 2-[(4-acetylphenyl)methyl]-6-[2-[(2-aminoacetyl)amino]ethoxy]-4-oxo-N-(2-oxopropyl)hexanamide |
|---|---|
| PubChem CID | 157056293 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-[(4-acetylphenyl)methyl]-6-[2-[(2-aminoacetyl)amino]ethoxy]-4-oxo-N-(2-oxopropyl)hexanamide |
| SMILES | CC(=O)CNC(=O)C(CC(=O)CCOCCNC(=O)CN)Cc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C22H31N3O6/c1-15(26)14-25-22(30)19(11-17-3-5-18(6-4-17)16(2)27)12-20(28)7-9-31-10-8-24-21(29)13-23/h3-6,19H,7-14,23H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | CGVAHOGGQCSAPN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|