C42H60N2O9S2 — CID 160977294
2-[2-[2-benzyl-9-[2-[2-(methylamino)ethyldisulfanyl]ethylamino]-4,9-dioxononanoyl]oxyethoxy]ethyl 2-benzyl-4,9-dioxodecanoate (PubChem CID 160977294) has the molecular formula C42H60N2O9S2 and a molecular weight of 801.08 g/mol. Its IUPAC name is 2-[2-[2-benzyl-9-[2-[2-(methylamino)ethyldisulfanyl]ethylamino]-4,9-dioxononanoyl]oxyethoxy]ethyl 2-benzyl-4,9-dioxodecanoate.
| Compound Name | 2-[2-[2-benzyl-9-[2-[2-(methylamino)ethyldisulfanyl]ethylamino]-4,9-dioxononanoyl]oxyethoxy]ethyl 2-benzyl-4,9-dioxodecanoate |
|---|---|
| PubChem CID | 160977294 |
| Molecular Formula | C42H60N2O9S2 |
| Molecular Weight | 801.08 g/mol |
| Exact Mass | 800.37 |
| IUPAC Name | 2-[2-[2-benzyl-9-[2-[2-(methylamino)ethyldisulfanyl]ethylamino]-4,9-dioxononanoyl]oxyethoxy]ethyl 2-benzyl-4,9-dioxodecanoate |
| SMILES | CNCCSSCCNC(=O)CCCCC(=O)CC(Cc1ccccc1)C(=O)OCCOCCOC(=O)C(CC(=O)CCCCC(C)=O)Cc1ccccc1 |
| InChI | InChI=1S/C42H60N2O9S2/c1-33(45)13-9-10-18-38(46)31-36(29-34-14-5-3-6-15-34)41(49)52-25-23-51-24-26-53-42(50)37(30-35-16-7-4-8-17-35)32-39(47)19-11-12-20-40(48)44-22-28-55-54-27-21-43-2/h3-8,14-17,36-37,43H,9-13,18-32H2,1-2H3,(H,44,48) |
| InChIKey | ZXVFNOMAWVNOOH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 154.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.08 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|