C24H40N4O8 — CID 88940364
(2R)-N'-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]-2-[(4-hydroxyphenyl)methyl]-N-propan-2-ylbutanediamide (PubChem CID 88940364) has the molecular formula C24H40N4O8 and a molecular weight of 512.60 g/mol. Its IUPAC name is (2R)-N'-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]-2-[(4-hydroxyphenyl)methyl]-N-propan-2-ylbutanediamide.
| Compound Name | (2R)-N'-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]-2-[(4-hydroxyphenyl)methyl]-N-propan-2-ylbutanediamide |
|---|---|
| PubChem CID | 88940364 |
| Molecular Formula | C24H40N4O8 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | (2R)-N'-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]-2-[(4-hydroxyphenyl)methyl]-N-propan-2-ylbutanediamide |
| SMILES | CC(C)NC(=O)[C@@H](CC(=O)NOCCOCCNC(=O)COCCOCCN)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C24H40N4O8/c1-18(2)27-24(32)20(15-19-3-5-21(29)6-4-19)16-22(30)28-36-14-13-34-10-8-26-23(31)17-35-12-11-33-9-7-25/h3-6,18,20,29H,7-17,25H2,1-2H3,(H,26,31)(H,27,32)(H,28,30)/t20-/m1/s1 |
| InChIKey | GDDQWFKATXWEOX-HXUWFJFHSA-N |
| XLogP | -0.36 |
| TPSA | 170.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|