C20H35IrOP2+ — CID 157059147
[3-di(propan-2-yl)phosphaniumyloxybenzene-2-id-1-yl]methyl-methyl-propan-2-ylphosphanium;iridium;propa-1,2-diene (PubChem CID 157059147) has the molecular formula C20H35IrOP2+ and a molecular weight of 545.66 g/mol. Its IUPAC name is [3-di(propan-2-yl)phosphaniumyloxybenzene-2-id-1-yl]methyl-methyl-propan-2-ylphosphanium;iridium;propa-1,2-diene.
| Compound Name | [3-di(propan-2-yl)phosphaniumyloxybenzene-2-id-1-yl]methyl-methyl-propan-2-ylphosphanium;iridium;propa-1,2-diene |
|---|---|
| PubChem CID | 157059147 |
| Molecular Formula | C20H35IrOP2+ |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | [3-di(propan-2-yl)phosphaniumyloxybenzene-2-id-1-yl]methyl-methyl-propan-2-ylphosphanium;iridium;propa-1,2-diene |
| SMILES | C=C=C.CC(C)[PH+](C)Cc1[c-]c(O[PH+](C(C)C)C(C)C)ccc1.[Ir] |
| InChI | InChI=1S/C17H29OP2.C3H4.Ir/c1-13(2)19(7)12-16-9-8-10-17(11-16)18-20(14(3)4)15(5)6;1-3-2;/h8-10,13-15H,12H2,1-7H3;1-2H2;/q-1;;/p+2 |
| InChIKey | SHJGKRZAEWONKS-UHFFFAOYSA-P |
| XLogP | 6.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|