C2N5NaO6 — CID 157071277
sodium;5-nitro-1,2,4-triazol-3-one;nitrate (PubChem CID 157071277) has the molecular formula C2N5NaO6 and a molecular weight of 213.04 g/mol. Its IUPAC name is sodium;5-nitro-1,2,4-triazol-3-one;nitrate.
| Compound Name | sodium;5-nitro-1,2,4-triazol-3-one;nitrate |
|---|---|
| PubChem CID | 157071277 |
| Molecular Formula | C2N5NaO6 |
| Molecular Weight | 213.04 g/mol |
| Exact Mass | 212.97 |
| IUPAC Name | sodium;5-nitro-1,2,4-triazol-3-one;nitrate |
| SMILES | O=C1N=NC([N+](=O)[O-])=N1.O=[N+]([O-])[O-].[Na+] |
| InChI | InChI=1S/C2N4O3.NO3.Na/c7-2-3-1(4-5-2)6(8)9;2-1(3)4;/q;-1;+1 |
| InChIKey | ACLQBCPOWXJYEI-UHFFFAOYSA-N |
| XLogP | -3.03 |
| TPSA | 163.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.04 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|