About sodium;5-nitro-1,2,4-triazol-3-one;nitrate
sodium;5-nitro-1,2,4-triazol-3-one;nitrate (PubChem CID 157071277) has the molecular formula C2N5NaO6
and a molecular weight of 213.04 g/mol. Its IUPAC name is sodium;5-nitro-1,2,4-triazol-3-one;nitrate.
Molecular Properties
| Compound Name | sodium;5-nitro-1,2,4-triazol-3-one;nitrate |
| PubChem CID | 157071277 |
| Molecular Formula | C2N5NaO6 |
| Molecular Weight | 213.04 g/mol |
| Exact Mass | 212.97 |
| IUPAC Name | sodium;5-nitro-1,2,4-triazol-3-one;nitrate |
| SMILES | O=C1N=NC([N+](=O)[O-])=N1.O=[N+]([O-])[O-].[Na+] |
| InChI | InChI=1S/C2N4O3.NO3.Na/c7-2-3-1(4-5-2)6(8)9;2-1(3)4;/q;-1;+1 |
| InChIKey | ACLQBCPOWXJYEI-UHFFFAOYSA-N |
| XLogP | -3.03 |
| TPSA | 163.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.04 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;5-nitro-1,2,4-triazol-3-one;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;5-nitro-1,2,4-triazol-3-one;nitrate?
The IUPAC name of sodium;5-nitro-1,2,4-triazol-3-one;nitrate (CID 157071277) is sodium;5-nitro-1,2,4-triazol-3-one;nitrate.
What is the SMILES notation for sodium;5-nitro-1,2,4-triazol-3-one;nitrate?
The canonical SMILES for sodium;5-nitro-1,2,4-triazol-3-one;nitrate is O=C1N=NC([N+](=O)[O-])=N1.O=[N+]([O-])[O-].[Na+].
What is the InChIKey of sodium;5-nitro-1,2,4-triazol-3-one;nitrate?
The InChIKey is ACLQBCPOWXJYEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2N4O3.NO3.Na/c7-2-3-1(4-5-2)6(8)9;2-1(3)4;/q;-1;+1.
What are the key properties of sodium;5-nitro-1,2,4-triazol-3-one;nitrate?
sodium;5-nitro-1,2,4-triazol-3-one;nitrate has a molecular weight of 213.04 g/mol, XLogP of -3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;5-nitro-1,2,4-triazol-3-one;nitrate is sourced from PubChem (CID 157071277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).