C2H4N6O6 — CID 162022381
azanium;5-nitro-1,2,4-triazol-3-one;nitrate (PubChem CID 162022381) has the molecular formula C2H4N6O6 and a molecular weight of 208.09 g/mol. Its IUPAC name is azanium;5-nitro-1,2,4-triazol-3-one;nitrate.
| Compound Name | azanium;5-nitro-1,2,4-triazol-3-one;nitrate |
|---|---|
| PubChem CID | 162022381 |
| Molecular Formula | C2H4N6O6 |
| Molecular Weight | 208.09 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | azanium;5-nitro-1,2,4-triazol-3-one;nitrate |
| SMILES | O=C1N=NC([N+](=O)[O-])=N1.O=[N+]([O-])[O-].[NH4+] |
| InChI | InChI=1S/C2N4O3.NO3.H3N/c7-2-3-1(4-5-2)6(8)9;2-1(3)4;/h;;1H3/q;-1;/p+1 |
| InChIKey | YUXJTKUUYSFSTN-UHFFFAOYSA-O |
| XLogP | 0.34 |
| TPSA | 199.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.09 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|