About methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene
methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene (PubChem CID 157087220) has the molecular formula C15H21NO6S
and a molecular weight of 343.40 g/mol. Its IUPAC name is methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene.
Molecular Properties
| Compound Name | methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene |
| PubChem CID | 157087220 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene |
| SMILES | CN.COC(=O)OCCS(=O)(=O)O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C4H8O6S.CH5N/c1-2-6-10-8-4-3-7-9(10)5-1;1-9-4(5)10-2-3-11(6,7)8;1-2/h1-8H;2-3H2,1H3,(H,6,7,8);2H2,1H3 |
| InChIKey | AEFQIZYOUDUVCJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene?
The IUPAC name of methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene (CID 157087220) is methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene.
What is the SMILES notation for methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene?
The canonical SMILES for methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene is CN.COC(=O)OCCS(=O)(=O)O.c1ccc2ccccc2c1.
What is the InChIKey of methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene?
The InChIKey is AEFQIZYOUDUVCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C4H8O6S.CH5N/c1-2-6-10-8-4-3-7-9(10)5-1;1-9-4(5)10-2-3-11(6,7)8;1-2/h1-8H;2-3H2,1H3,(H,6,7,8);2H2,1H3.
What are the key properties of methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene?
methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene has a molecular weight of 343.40 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;2-methoxycarbonyloxyethanesulfonic acid;naphthalene is sourced from PubChem (CID 157087220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).