C28H37F3N4O4 — CID 157088507
methane;3-[4-(4-methoxyphenyl)piperidin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]propan-1-one (PubChem CID 157088507) has the molecular formula C28H37F3N4O4 and a molecular weight of 550.62 g/mol. Its IUPAC name is methane;3-[4-(4-methoxyphenyl)piperidin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]propan-1-one.
| Compound Name | methane;3-[4-(4-methoxyphenyl)piperidin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 157088507 |
| Molecular Formula | C28H37F3N4O4 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | methane;3-[4-(4-methoxyphenyl)piperidin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]propan-1-one |
| SMILES | C.COc1ccc(C2CCN(CCC(=O)N3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H33F3N4O4.CH4/c1-38-23-5-2-19(3-6-23)20-8-13-32(14-9-20)15-12-26(35)33-16-10-21(11-17-33)31-22-4-7-25(34(36)37)24(18-22)27(28,29)30;/h2-7,18,20-21,31H,8-17H2,1H3;1H4 |
| InChIKey | AEJMGFPWGSKLOW-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|