C30H31FN4O4 — CID 157091078
N-cyclopropyl-3-fluoro-4-methyl-5-[1-[4-(oxolan-2-ylmethylamino)phenyl]indazol-5-yl]benzamide;formic acid (PubChem CID 157091078) has the molecular formula C30H31FN4O4 and a molecular weight of 530.60 g/mol. Its IUPAC name is N-cyclopropyl-3-fluoro-4-methyl-5-[1-[4-(oxolan-2-ylmethylamino)phenyl]indazol-5-yl]benzamide;formic acid.
| Compound Name | N-cyclopropyl-3-fluoro-4-methyl-5-[1-[4-(oxolan-2-ylmethylamino)phenyl]indazol-5-yl]benzamide;formic acid |
|---|---|
| PubChem CID | 157091078 |
| Molecular Formula | C30H31FN4O4 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | N-cyclopropyl-3-fluoro-4-methyl-5-[1-[4-(oxolan-2-ylmethylamino)phenyl]indazol-5-yl]benzamide;formic acid |
| SMILES | Cc1c(F)cc(C(=O)NC2CC2)cc1-c1ccc2c(cnn2-c2ccc(NCC3CCCO3)cc2)c1.O=CO |
| InChI | InChI=1S/C29H29FN4O2.CH2O2/c1-18-26(14-20(15-27(18)30)29(35)33-23-5-6-23)19-4-11-28-21(13-19)16-32-34(28)24-9-7-22(8-10-24)31-17-25-3-2-12-36-25;2-1-3/h4,7-11,13-16,23,25,31H,2-3,5-6,12,17H2,1H3,(H,33,35);1H,(H,2,3) |
| InChIKey | AERBMEJXRIHIJL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|