C50H54Cl2F2N10O4 — CID 157093094
4-[3-amino-6-(4-aminocyclohexyl)pyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide (PubChem CID 157093094) has the molecular formula C50H54Cl2F2N10O4 and a molecular weight of 967.95 g/mol. Its IUPAC name is 4-[3-amino-6-(4-aminocyclohexyl)pyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide.
| Compound Name | 4-[3-amino-6-(4-aminocyclohexyl)pyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 157093094 |
| Molecular Formula | C50H54Cl2F2N10O4 |
| Molecular Weight | 967.95 g/mol |
| Exact Mass | 966.37 |
| IUPAC Name | 4-[3-amino-6-(4-aminocyclohexyl)pyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide |
| SMILES | Nc1ncc(C2CCC(N)CC2)nc1-c1ccc(C(=O)N[C@H](CO)c2cccc(Cl)c2)c(F)c1.Nc1ncc(C2CCC(N)CC2)nc1-c1ccc(C(=O)N[C@H](CO)c2cccc(Cl)c2)c(F)c1 |
| InChI | InChI=1S/2C25H27ClFN5O2/c2*26-17-3-1-2-15(10-17)22(13-33)32-25(34)19-9-6-16(11-20(19)27)23-24(29)30-12-21(31-23)14-4-7-18(28)8-5-14/h2*1-3,6,9-12,14,18,22,33H,4-5,7-8,13,28H2,(H2,29,30)(H,32,34)/t2*14?,18?,22-/m11/s1 |
| InChIKey | AEWYEFWDRRISMR-BKXWQZJNSA-N |
| XLogP | 7.93 |
| TPSA | 254.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.95 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |