tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid

C16H28O8 — CID 157094558

IUPACtert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid
SMILESCOC(CC(C)=O)C(=O)O.COC(CC(C)=O)C(=O)OC(C)(C)C
InChIInChI=1S/C10H18O4.C6H10O4/c1-7(11)6-8(13-5)9(12)14-10(2,3)4;1-4(7)3-5(10-2)6(8)9/h8H,6H2,1-5H3;5H,3H2,1-2H3,(H,8,9)
InChIKeyAFBBZYLHQTWMMO-UHFFFAOYSA-N
MW348.39 g/mol
LogP1.39
Rot. Bonds8

About tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid

tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid (PubChem CID 157094558) has the molecular formula C16H28O8 and a molecular weight of 348.39 g/mol. Its IUPAC name is tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid.

Molecular Properties

Compound Nametert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid
PubChem CID157094558
Molecular FormulaC16H28O8
Molecular Weight348.39 g/mol
Exact Mass348.18
IUPAC Nametert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid
SMILESCOC(CC(C)=O)C(=O)O.COC(CC(C)=O)C(=O)OC(C)(C)C
InChIInChI=1S/C10H18O4.C6H10O4/c1-7(11)6-8(13-5)9(12)14-10(2,3)4;1-4(7)3-5(10-2)6(8)9/h8H,6H2,1-5H3;5H,3H2,1-2H3,(H,8,9)
InChIKeyAFBBZYLHQTWMMO-UHFFFAOYSA-N
XLogP1.39
TPSA116.20 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds8
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500348.39
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid?
The IUPAC name of tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid (CID 157094558) is tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid.
What is the SMILES notation for tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid?
The canonical SMILES for tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid is COC(CC(C)=O)C(=O)O.COC(CC(C)=O)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid?
The InChIKey is AFBBZYLHQTWMMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4.C6H10O4/c1-7(11)6-8(13-5)9(12)14-10(2,3)4;1-4(7)3-5(10-2)6(8)9/h8H,6H2,1-5H3;5H,3H2,1-2H3,(H,8,9).
What are the key properties of tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid?
tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid has a molecular weight of 348.39 g/mol, XLogP of 1.39, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-methoxy-4-oxopentanoate;2-methoxy-4-oxopentanoic acid is sourced from PubChem (CID 157094558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).