C17H14O2S — CID 157104762
8-methyl-6,11-dihydroindeno[1,2-c]thiochromene 5,5-dioxide (PubChem CID 157104762) has the molecular formula C17H14O2S and a molecular weight of 282.36 g/mol. Its IUPAC name is 8-methyl-6,11-dihydroindeno[1,2-c]thiochromene 5,5-dioxide.
| Compound Name | 8-methyl-6,11-dihydroindeno[1,2-c]thiochromene 5,5-dioxide |
|---|---|
| PubChem CID | 157104762 |
| Molecular Formula | C17H14O2S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 8-methyl-6,11-dihydroindeno[1,2-c]thiochromene 5,5-dioxide |
| SMILES | Cc1ccc2c(c1)C1=C(C2)c2ccccc2S(=O)(=O)C1 |
| InChI | InChI=1S/C17H14O2S/c1-11-6-7-12-9-15-13-4-2-3-5-17(13)20(18,19)10-16(15)14(12)8-11/h2-8H,9-10H2,1H3 |
| InChIKey | BWVCYLGKUBKJPY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|