C41H35F2N7O3 — CID 157108262
4-[1-[(4-fluorophenyl)methyl]pyrrolo[2,3-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole;4-[1-[(4-fluorophenyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole;1,2-oxazole (PubChem CID 157108262) has the molecular formula C41H35F2N7O3 and a molecular weight of 711.77 g/mol. Its IUPAC name is 4-[1-[(4-fluorophenyl)methyl]pyrrolo[2,3-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole;4-[1-[(4-fluorophenyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole;1,2-oxazole.
| Compound Name | 4-[1-[(4-fluorophenyl)methyl]pyrrolo[2,3-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole;4-[1-[(4-fluorophenyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole;1,2-oxazole |
|---|---|
| PubChem CID | 157108262 |
| Molecular Formula | C41H35F2N7O3 |
| Molecular Weight | 711.77 g/mol |
| Exact Mass | 711.28 |
| IUPAC Name | 4-[1-[(4-fluorophenyl)methyl]pyrrolo[2,3-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole;4-[1-[(4-fluorophenyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole;1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1ccc2ccn(Cc3ccc(F)cc3)c2n1.Cc1noc(C)c1-c1cnc2ccn(Cc3ccc(F)cc3)c2c1.c1cnoc1 |
| InChI | InChI=1S/2C19H16FN3O.C3H3NO/c1-12-18(13(2)24-22-12)17-8-5-15-9-10-23(19(15)21-17)11-14-3-6-16(20)7-4-14;1-12-19(13(2)24-22-12)15-9-18-17(21-10-15)7-8-23(18)11-14-3-5-16(20)6-4-14;1-2-4-5-3-1/h2*3-10H,11H2,1-2H3;1-3H |
| InChIKey | AGOACSHIFGZKCZ-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 113.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.77 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|