C7H8F3N3O2 — CID 157116190
N-(2,2,2-trifluoroethoxymethyl)-1H-pyrazole-5-carboxamide (PubChem CID 157116190) has the molecular formula C7H8F3N3O2 and a molecular weight of 223.15 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethoxymethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2,2,2-trifluoroethoxymethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 157116190 |
| Molecular Formula | C7H8F3N3O2 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | N-(2,2,2-trifluoroethoxymethyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCOCC(F)(F)F)c1ccn[nH]1 |
| InChI | InChI=1S/C7H8F3N3O2/c8-7(9,10)3-15-4-11-6(14)5-1-2-12-13-5/h1-2H,3-4H2,(H,11,14)(H,12,13) |
| InChIKey | AHKYCRLOKPUPDT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|