C29H29B6F3O9S — CID 157118011
CID 157118011 (PubChem CID 157118011) has the molecular formula C29H29B6F3O9S and a molecular weight of 675.48 g/mol.
| Compound Name | CID 157118011 |
|---|---|
| PubChem CID | 157118011 |
| Molecular Formula | C29H29B6F3O9S |
| Molecular Weight | 675.48 g/mol |
| Exact Mass | 676.20 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc(C[B])c(C(=O)OCC(CC)(COC(=O)c2c(C[B])ccc(C[B])c2C[B])C(=O)OC(CS(=O)(=O)O)C(F)(F)F)c1C[B] |
| InChI | InChI=1S/C29H29B6F3O9S/c1-2-28(27(41)47-22(29(36,37)38)13-48(42,43)44,14-45-25(39)23-18(9-32)5-3-16(7-30)20(23)11-34)15-46-26(40)24-19(10-33)6-4-17(8-31)21(24)12-35/h3-6,22H,2,7-15H2,1H3,(H,42,43,44) |
| InChIKey | SHMIBGFJTRKUAY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|