C25H21Cl2F3N6O3 — CID 157121682
N-[(2R,3R)-3,4-bis(4-chlorophenyl)butan-2-yl]-3-(2H-tetrazol-1-ium-1-yl)pyridine-4-carboxamide;2,2,2-trifluoroacetate (PubChem CID 157121682) has the molecular formula C25H21Cl2F3N6O3 and a molecular weight of 581.38 g/mol. Its IUPAC name is N-[(2R,3R)-3,4-bis(4-chlorophenyl)butan-2-yl]-3-(2H-tetrazol-1-ium-1-yl)pyridine-4-carboxamide;2,2,2-trifluoroacetate.
| Compound Name | N-[(2R,3R)-3,4-bis(4-chlorophenyl)butan-2-yl]-3-(2H-tetrazol-1-ium-1-yl)pyridine-4-carboxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 157121682 |
| Molecular Formula | C25H21Cl2F3N6O3 |
| Molecular Weight | 581.38 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | N-[(2R,3R)-3,4-bis(4-chlorophenyl)butan-2-yl]-3-(2H-tetrazol-1-ium-1-yl)pyridine-4-carboxamide;2,2,2-trifluoroacetate |
| SMILES | C[C@@H](NC(=O)c1ccncc1-[n+]1cnn[nH]1)[C@H](Cc1ccc(Cl)cc1)c1ccc(Cl)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C23H20Cl2N6O.C2HF3O2/c1-15(28-23(32)20-10-11-26-13-22(20)31-14-27-29-30-31)21(17-4-8-19(25)9-5-17)12-16-2-6-18(24)7-3-16;3-2(4,5)1(6)7/h2-11,13-15,21H,12H2,1H3,(H,28,32);(H,6,7)/t15-,21+;/m1./s1 |
| InChIKey | IZFIORIPXNTYHX-WSZABJOTSA-N |
| XLogP | 3.23 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|