C24H24O7S5 — CID 157124121
2,3-dihydro-1,4-benzodithiine;2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide;2,3-dihydro-1λ6,4λ6-benzodithiine 1,1,4,4-tetraoxide (PubChem CID 157124121) has the molecular formula C24H24O7S5 and a molecular weight of 584.78 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodithiine;2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide;2,3-dihydro-1λ6,4λ6-benzodithiine 1,1,4,4-tetraoxide.
| Compound Name | 2,3-dihydro-1,4-benzodithiine;2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide;2,3-dihydro-1λ6,4λ6-benzodithiine 1,1,4,4-tetraoxide |
|---|---|
| PubChem CID | 157124121 |
| Molecular Formula | C24H24O7S5 |
| Molecular Weight | 584.78 g/mol |
| Exact Mass | 584.01 |
| IUPAC Name | 2,3-dihydro-1,4-benzodithiine;2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide;2,3-dihydro-1λ6,4λ6-benzodithiine 1,1,4,4-tetraoxide |
| SMILES | O=S1(=O)CCOc2ccccc21.O=S1(=O)CCS(=O)(=O)c2ccccc21.c1ccc2c(c1)SCCS2 |
| InChI | InChI=1S/C8H8O4S2.C8H8O3S.C8H8S2/c9-13(10)5-6-14(11,12)8-4-2-1-3-7(8)13;9-12(10)6-5-11-7-3-1-2-4-8(7)12;1-2-4-8-7(3-1)9-5-6-10-8/h1-4H,5-6H2;1-4H,5-6H2;1-4H,5-6H2 |
| InChIKey | AIHXKGXGNDMZLW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 111.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.78 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |