C22H24FN3O5S — CID 157126285
3-[3-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpropyl]pyrrolo[3,4-b]pyrazine-5,7-dione (PubChem CID 157126285) has the molecular formula C22H24FN3O5S and a molecular weight of 461.52 g/mol. Its IUPAC name is 3-[3-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpropyl]pyrrolo[3,4-b]pyrazine-5,7-dione.
| Compound Name | 3-[3-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpropyl]pyrrolo[3,4-b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 157126285 |
| Molecular Formula | C22H24FN3O5S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 3-[3-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpropyl]pyrrolo[3,4-b]pyrazine-5,7-dione |
| SMILES | C[C@@H](CS(=O)(=O)CCCc1cnc2c(n1)C(=O)NC2=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C22H24FN3O5S/c1-13(15-6-7-17(23)18(9-15)31-11-14-4-5-14)12-32(29,30)8-2-3-16-10-24-19-20(25-16)22(28)26-21(19)27/h6-7,9-10,13-14H,2-5,8,11-12H2,1H3,(H,26,27,28)/t13-/m0/s1 |
| InChIKey | AINRKVFXBSPKKI-ZDUSSCGKSA-N |
| XLogP | 2.44 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|