C24H33FN2O6S — CID 159496956
5-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-3-methylbutyl]sulfonylpentyl]-1,3-diazinane-2,4,6-trione (PubChem CID 159496956) has the molecular formula C24H33FN2O6S and a molecular weight of 496.60 g/mol. Its IUPAC name is 5-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-3-methylbutyl]sulfonylpentyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-3-methylbutyl]sulfonylpentyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 159496956 |
| Molecular Formula | C24H33FN2O6S |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 5-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-3-methylbutyl]sulfonylpentyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)[C@@H](CS(=O)(=O)CCCCCC1C(=O)NC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C24H33FN2O6S/c1-15(2)19(17-9-10-20(25)21(12-17)33-13-16-7-8-16)14-34(31,32)11-5-3-4-6-18-22(28)26-24(30)27-23(18)29/h9-10,12,15-16,18-19H,3-8,11,13-14H2,1-2H3,(H2,26,27,28,29,30)/t19-/m1/s1 |
| InChIKey | LYXCKHMSGNIALA-LJQANCHMSA-N |
| XLogP | 3.31 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|