C29H19Cl4F2NO6S — CID 157126620
ethyl 2,9-dichloro-3-fluoro-5-oxo-[1,3]benzothiazolo[3,2-a]quinoline-6-carboxylate;ethyl 3-(2,4-dichloro-5-fluorophenyl)-3-oxopropanoate (PubChem CID 157126620) has the molecular formula C29H19Cl4F2NO6S and a molecular weight of 689.35 g/mol. Its IUPAC name is ethyl 2,9-dichloro-3-fluoro-5-oxo-[1,3]benzothiazolo[3,2-a]quinoline-6-carboxylate;ethyl 3-(2,4-dichloro-5-fluorophenyl)-3-oxopropanoate.
| Compound Name | ethyl 2,9-dichloro-3-fluoro-5-oxo-[1,3]benzothiazolo[3,2-a]quinoline-6-carboxylate;ethyl 3-(2,4-dichloro-5-fluorophenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 157126620 |
| Molecular Formula | C29H19Cl4F2NO6S |
| Molecular Weight | 689.35 g/mol |
| Exact Mass | 686.97 |
| IUPAC Name | ethyl 2,9-dichloro-3-fluoro-5-oxo-[1,3]benzothiazolo[3,2-a]quinoline-6-carboxylate;ethyl 3-(2,4-dichloro-5-fluorophenyl)-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1cc(F)c(Cl)cc1Cl.CCOC(=O)c1c(=O)c2cc(F)c(Cl)cc2n2c1sc1cc(Cl)ccc12 |
| InChI | InChI=1S/C18H10Cl2FNO3S.C11H9Cl2FO3/c1-2-25-18(24)15-16(23)9-6-11(21)10(20)7-13(9)22-12-4-3-8(19)5-14(12)26-17(15)22;1-2-17-11(16)5-10(15)6-3-9(14)8(13)4-7(6)12/h3-7H,2H2,1H3;3-4H,2,5H2,1H3 |
| InChIKey | AIOQVAJKHIRGOF-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.35 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|