C16H11NO3S2 — CID 24798179
ethyl 7-oxo-3,10-dithia-1-azatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),4,8,11,13,15-hexaene-8-carboxylate (PubChem CID 24798179) has the molecular formula C16H11NO3S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl 7-oxo-3,10-dithia-1-azatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),4,8,11,13,15-hexaene-8-carboxylate.
| Compound Name | ethyl 7-oxo-3,10-dithia-1-azatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),4,8,11,13,15-hexaene-8-carboxylate |
|---|---|
| PubChem CID | 24798179 |
| Molecular Formula | C16H11NO3S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | ethyl 7-oxo-3,10-dithia-1-azatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),4,8,11,13,15-hexaene-8-carboxylate |
| SMILES | CCOC(=O)c1c(=O)c2ccsc2n2c1sc1ccccc12 |
| InChI | InChI=1S/C16H11NO3S2/c1-2-20-16(19)12-13(18)9-7-8-21-14(9)17-10-5-3-4-6-11(10)22-15(12)17/h3-8H,2H2,1H3 |
| InChIKey | AYKZZGSIJMYDDW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |