C20H17ClFNO4S — CID 53415340
ethyl 1-benzyl-7-chloro-6-fluoro-2-methylsulfinyl-4-oxoquinoline-3-carboxylate (PubChem CID 53415340) has the molecular formula C20H17ClFNO4S and a molecular weight of 421.88 g/mol. Its IUPAC name is ethyl 1-benzyl-7-chloro-6-fluoro-2-methylsulfinyl-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-benzyl-7-chloro-6-fluoro-2-methylsulfinyl-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 53415340 |
| Molecular Formula | C20H17ClFNO4S |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | ethyl 1-benzyl-7-chloro-6-fluoro-2-methylsulfinyl-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(S(C)=O)n(Cc2ccccc2)c2cc(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C20H17ClFNO4S/c1-3-27-20(25)17-18(24)13-9-15(22)14(21)10-16(13)23(19(17)28(2)26)11-12-7-5-4-6-8-12/h4-10H,3,11H2,1-2H3 |
| InChIKey | XEKGOVIYTPPWGU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |