C26H30F3NO3S2 — CID 157128047
N-ethylethanamine;5-[2-methyl-3-[4-(trifluoromethyl)phenyl]-1-benzothiophen-6-yl]pent-4-ynyl methanesulfonate (PubChem CID 157128047) has the molecular formula C26H30F3NO3S2 and a molecular weight of 525.66 g/mol. Its IUPAC name is N-ethylethanamine;5-[2-methyl-3-[4-(trifluoromethyl)phenyl]-1-benzothiophen-6-yl]pent-4-ynyl methanesulfonate.
| Compound Name | N-ethylethanamine;5-[2-methyl-3-[4-(trifluoromethyl)phenyl]-1-benzothiophen-6-yl]pent-4-ynyl methanesulfonate |
|---|---|
| PubChem CID | 157128047 |
| Molecular Formula | C26H30F3NO3S2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | N-ethylethanamine;5-[2-methyl-3-[4-(trifluoromethyl)phenyl]-1-benzothiophen-6-yl]pent-4-ynyl methanesulfonate |
| SMILES | CCNCC.Cc1sc2cc(C#CCCCOS(C)(=O)=O)ccc2c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H19F3O3S2.C4H11N/c1-15-21(17-8-10-18(11-9-17)22(23,24)25)19-12-7-16(14-20(19)29-15)6-4-3-5-13-28-30(2,26)27;1-3-5-4-2/h7-12,14H,3,5,13H2,1-2H3;5H,3-4H2,1-2H3 |
| InChIKey | AISSFTRXOASLNP-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|