C37H30N2OS — CID 157130499
4-tert-butyl-2-[5-[3-(9-pyridin-2-ylfluoren-9-yl)phenoxy]thiophen-3-yl]pyridine (PubChem CID 157130499) has the molecular formula C37H30N2OS and a molecular weight of 550.73 g/mol. Its IUPAC name is 4-tert-butyl-2-[5-[3-(9-pyridin-2-ylfluoren-9-yl)phenoxy]thiophen-3-yl]pyridine.
| Compound Name | 4-tert-butyl-2-[5-[3-(9-pyridin-2-ylfluoren-9-yl)phenoxy]thiophen-3-yl]pyridine |
|---|---|
| PubChem CID | 157130499 |
| Molecular Formula | C37H30N2OS |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 4-tert-butyl-2-[5-[3-(9-pyridin-2-ylfluoren-9-yl)phenoxy]thiophen-3-yl]pyridine |
| SMILES | CC(C)(C)c1ccnc(-c2csc(Oc3cccc(C4(c5ccccn5)c5ccccc5-c5ccccc54)c3)c2)c1 |
| InChI | InChI=1S/C37H30N2OS/c1-36(2,3)26-18-20-38-33(23-26)25-21-35(41-24-25)40-28-12-10-11-27(22-28)37(34-17-8-9-19-39-34)31-15-6-4-13-29(31)30-14-5-7-16-32(30)37/h4-24H,1-3H3 |
| InChIKey | VOTQSQGIMAZZMO-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |