C10H18ClNO2S — CID 15713182
2-chloro-1-[5-(ethylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone (PubChem CID 15713182) has the molecular formula C10H18ClNO2S and a molecular weight of 251.78 g/mol. Its IUPAC name is 2-chloro-1-[5-(ethylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone.
| Compound Name | 2-chloro-1-[5-(ethylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 15713182 |
| Molecular Formula | C10H18ClNO2S |
| Molecular Weight | 251.78 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-chloro-1-[5-(ethylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone |
| SMILES | CCSCC1CN(C(=O)CCl)C(C)(C)O1 |
| InChI | InChI=1S/C10H18ClNO2S/c1-4-15-7-8-6-12(9(13)5-11)10(2,3)14-8/h8H,4-7H2,1-3H3 |
| InChIKey | HUAKRIAVDVAKSD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.78 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|