About CID 157144485
CID 157144485 (PubChem CID 157144485) has the molecular formula C48H48BBrN10O6
and a molecular weight of 951.69 g/mol.
Molecular Properties
| Compound Name | CID 157144485 |
| PubChem CID | 157144485 |
| Molecular Formula | C48H48BBrN10O6 |
| Molecular Weight | 951.69 g/mol |
| Exact Mass | 950.30 |
| IUPAC Name | — |
| SMILES | Cc1onc2c1CC1(CC2)Cc2ccc(-c3cccnc3)cc2C12N=C(N)N(C)C2=O.Cc1onc2c1CC1(CC2)Cc2ccc(Br)cc2C12N=C(N)N(C)C2=O.OB(O)c1cccnc1 |
| InChI | InChI=1S/C24H23N5O2.C19H19BrN4O2.C5H6BNO2/c1-14-18-12-23(8-7-20(18)28-31-14)11-16-6-5-15(17-4-3-9-26-13-17)10-19(16)24(23)21(30)29(2)22(25)27-24;1-10-13-9-18(6-5-15(13)23-26-10)8-11-3-4-12(20)7-14(11)19(18)16(25)24(2)17(21)22-19;8-6(9)5-2-1-3-7-4-5/h3-6,9-10,13H,7-8,11-12H2,1-2H3,(H2,25,27);3-4,7H,5-6,8-9H2,1-2H3,(H2,21,22);1-4,8-9H |
| InChIKey | AKOAOGPLHSAAKW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 235.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 951.69 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 157144485 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157144485?
The IUPAC name of CID 157144485 (CID 157144485) is not available.
What is the SMILES notation for CID 157144485?
The canonical SMILES for CID 157144485 is Cc1onc2c1CC1(CC2)Cc2ccc(-c3cccnc3)cc2C12N=C(N)N(C)C2=O.Cc1onc2c1CC1(CC2)Cc2ccc(Br)cc2C12N=C(N)N(C)C2=O.OB(O)c1cccnc1.
What is the InChIKey of CID 157144485?
The InChIKey is AKOAOGPLHSAAKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N5O2.C19H19BrN4O2.C5H6BNO2/c1-14-18-12-23(8-7-20(18)28-31-14)11-16-6-5-15(17-4-3-9-26-13-17)10-19(16)24(23)21(30)29(2)22(25)27-24;1-10-13-9-18(6-5-15(13)23-26-10)8-11-3-4-12(20)7-14(11)19(18)16(25)24(2)17(21)22-19;8-6(9)5-2-1-3-7-4-5/h3-6,9-10,13H,7-8,11-12H2,1-2H3,(H2,25,27);3-4,7H,5-6,8-9H2,1-2H3,(H2,21,22);1-4,8-9H.
What are the key properties of CID 157144485?
CID 157144485 has a molecular weight of 951.69 g/mol, XLogP of 3.98, 2 rotatable bonds, 4 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157144485 is sourced from PubChem (CID 157144485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).