C48H48BBrN10O6 — CID 157144485
CID 157144485 (PubChem CID 157144485) has the molecular formula C48H48BBrN10O6 and a molecular weight of 951.69 g/mol.
| Compound Name | CID 157144485 |
|---|---|
| PubChem CID | 157144485 |
| Molecular Formula | C48H48BBrN10O6 |
| Molecular Weight | 951.69 g/mol |
| Exact Mass | 950.30 |
| IUPAC Name | — |
| SMILES | Cc1onc2c1CC1(CC2)Cc2ccc(-c3cccnc3)cc2C12N=C(N)N(C)C2=O.Cc1onc2c1CC1(CC2)Cc2ccc(Br)cc2C12N=C(N)N(C)C2=O.OB(O)c1cccnc1 |
| InChI | InChI=1S/C24H23N5O2.C19H19BrN4O2.C5H6BNO2/c1-14-18-12-23(8-7-20(18)28-31-14)11-16-6-5-15(17-4-3-9-26-13-17)10-19(16)24(23)21(30)29(2)22(25)27-24;1-10-13-9-18(6-5-15(13)23-26-10)8-11-3-4-12(20)7-14(11)19(18)16(25)24(2)17(21)22-19;8-6(9)5-2-1-3-7-4-5/h3-6,9-10,13H,7-8,11-12H2,1-2H3,(H2,25,27);3-4,7H,5-6,8-9H2,1-2H3,(H2,21,22);1-4,8-9H |
| InChIKey | AKOAOGPLHSAAKW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 235.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.69 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|