C27H34 — CID 157145365
1,4-dimethyl-2,5-bis(3,4,5-trimethylphenyl)benzene;methane (PubChem CID 157145365) has the molecular formula C27H34 and a molecular weight of 358.57 g/mol. Its IUPAC name is 1,4-dimethyl-2,5-bis(3,4,5-trimethylphenyl)benzene;methane.
| Compound Name | 1,4-dimethyl-2,5-bis(3,4,5-trimethylphenyl)benzene;methane |
|---|---|
| PubChem CID | 157145365 |
| Molecular Formula | C27H34 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 1,4-dimethyl-2,5-bis(3,4,5-trimethylphenyl)benzene;methane |
| SMILES | C.Cc1cc(-c2cc(C)c(C)c(C)c2)c(C)cc1-c1cc(C)c(C)c(C)c1 |
| InChI | InChI=1S/C26H30.CH4/c1-15-9-23(10-16(2)21(15)7)25-13-20(6)26(14-19(25)5)24-11-17(3)22(8)18(4)12-24;/h9-14H,1-8H3;1H4 |
| InChIKey | AKQHJHITEWDKPZ-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |