C37H76N2O4 — CID 157146659
2,9-dimethyldecan-5-yl 4-(dimethylamino)butanoate;2,9-dimethyldecan-5-yl 5-(dimethylamino)pentanoate (PubChem CID 157146659) has the molecular formula C37H76N2O4 and a molecular weight of 613.03 g/mol. Its IUPAC name is 2,9-dimethyldecan-5-yl 4-(dimethylamino)butanoate;2,9-dimethyldecan-5-yl 5-(dimethylamino)pentanoate.
| Compound Name | 2,9-dimethyldecan-5-yl 4-(dimethylamino)butanoate;2,9-dimethyldecan-5-yl 5-(dimethylamino)pentanoate |
|---|---|
| PubChem CID | 157146659 |
| Molecular Formula | C37H76N2O4 |
| Molecular Weight | 613.03 g/mol |
| Exact Mass | 612.58 |
| IUPAC Name | 2,9-dimethyldecan-5-yl 4-(dimethylamino)butanoate;2,9-dimethyldecan-5-yl 5-(dimethylamino)pentanoate |
| SMILES | CC(C)CCCC(CCC(C)C)OC(=O)CCCCN(C)C.CC(C)CCCC(CCC(C)C)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C19H39NO2.C18H37NO2/c1-16(2)10-9-11-18(14-13-17(3)4)22-19(21)12-7-8-15-20(5)6;1-15(2)9-7-10-17(13-12-16(3)4)21-18(20)11-8-14-19(5)6/h16-18H,7-15H2,1-6H3;15-17H,7-14H2,1-6H3 |
| InChIKey | AKTYWAIUCRXPEJ-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.03 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|