C49H91NO6 — CID 123721786
dipropan-2-yl 19-[4-(dimethylamino)butanoyloxy]heptatriaconta-9,28-dienedioate (PubChem CID 123721786) has the molecular formula C49H91NO6 and a molecular weight of 790.27 g/mol. Its IUPAC name is dipropan-2-yl 19-[4-(dimethylamino)butanoyloxy]heptatriaconta-9,28-dienedioate.
| Compound Name | dipropan-2-yl 19-[4-(dimethylamino)butanoyloxy]heptatriaconta-9,28-dienedioate |
|---|---|
| PubChem CID | 123721786 |
| Molecular Formula | C49H91NO6 |
| Molecular Weight | 790.27 g/mol |
| Exact Mass | 789.68 |
| IUPAC Name | dipropan-2-yl 19-[4-(dimethylamino)butanoyloxy]heptatriaconta-9,28-dienedioate |
| SMILES | CC(C)OC(=O)CCCCCCCC=CCCCCCCCCC(CCCCCCCCC=CCCCCCCCC(=O)OC(C)C)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C49H91NO6/c1-44(2)54-47(51)40-35-31-27-23-19-15-11-7-9-13-17-21-25-29-33-38-46(56-49(53)42-37-43-50(5)6)39-34-30-26-22-18-14-10-8-12-16-20-24-28-32-36-41-48(52)55-45(3)4/h7-8,11-12,44-46H,9-10,13-43H2,1-6H3 |
| InChIKey | WBNUPDAOWBNEPM-UHFFFAOYSA-N |
| XLogP | 13.96 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.27 |
| LogP ≤ 5 | 13.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|