C45H87NO6 — CID 71610324
bis(6-methyl-3-propan-2-ylheptyl) 9-[4-(dimethylamino)butanoyloxy]heptadecanedioate (PubChem CID 71610324) has the molecular formula C45H87NO6 and a molecular weight of 738.19 g/mol. Its IUPAC name is bis(6-methyl-3-propan-2-ylheptyl) 9-[4-(dimethylamino)butanoyloxy]heptadecanedioate.
| Compound Name | bis(6-methyl-3-propan-2-ylheptyl) 9-[4-(dimethylamino)butanoyloxy]heptadecanedioate |
|---|---|
| PubChem CID | 71610324 |
| Molecular Formula | C45H87NO6 |
| Molecular Weight | 738.19 g/mol |
| Exact Mass | 737.65 |
| IUPAC Name | bis(6-methyl-3-propan-2-ylheptyl) 9-[4-(dimethylamino)butanoyloxy]heptadecanedioate |
| SMILES | CC(C)CCC(CCOC(=O)CCCCCCCC(CCCCCCCC(=O)OCCC(CCC(C)C)C(C)C)OC(=O)CCCN(C)C)C(C)C |
| InChI | InChI=1S/C45H87NO6/c1-36(2)27-29-40(38(5)6)31-34-50-43(47)24-19-15-11-13-17-22-42(52-45(49)26-21-33-46(9)10)23-18-14-12-16-20-25-44(48)51-35-32-41(39(7)8)30-28-37(3)4/h36-42H,11-35H2,1-10H3 |
| InChIKey | QERRETOYKJWHKI-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.19 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|