C49H97NO4 — CID 167580076
bis(7-methyl-4-propan-2-yloctyl) 9-[6-(dimethylamino)hexyl]heptadecanedioate (PubChem CID 167580076) has the molecular formula C49H97NO4 and a molecular weight of 764.32 g/mol. Its IUPAC name is bis(7-methyl-4-propan-2-yloctyl) 9-[6-(dimethylamino)hexyl]heptadecanedioate.
| Compound Name | bis(7-methyl-4-propan-2-yloctyl) 9-[6-(dimethylamino)hexyl]heptadecanedioate |
|---|---|
| PubChem CID | 167580076 |
| Molecular Formula | C49H97NO4 |
| Molecular Weight | 764.32 g/mol |
| Exact Mass | 763.74 |
| IUPAC Name | bis(7-methyl-4-propan-2-yloctyl) 9-[6-(dimethylamino)hexyl]heptadecanedioate |
| SMILES | CC(C)CCC(CCCOC(=O)CCCCCCCC(CCCCCCCC(=O)OCCCC(CCC(C)C)C(C)C)CCCCCCN(C)C)C(C)C |
| InChI | InChI=1S/C49H97NO4/c1-41(2)34-36-46(43(5)6)30-25-39-53-48(51)32-22-15-11-13-19-27-45(29-21-17-18-24-38-50(9)10)28-20-14-12-16-23-33-49(52)54-40-26-31-47(44(7)8)37-35-42(3)4/h41-47H,11-40H2,1-10H3 |
| InChIKey | DLLUMXSWQNTZKC-UHFFFAOYSA-N |
| XLogP | 14.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.32 |
| LogP ≤ 5 | 14.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|