C45H79F6NO8 — CID 167543937
bis[9-oxo-9-(trifluoromethoxy)nonyl] 9-[6-(dimethylamino)hexyl]heptadecanedioate (PubChem CID 167543937) has the molecular formula C45H79F6NO8 and a molecular weight of 876.11 g/mol. Its IUPAC name is bis[9-oxo-9-(trifluoromethoxy)nonyl] 9-[6-(dimethylamino)hexyl]heptadecanedioate.
| Compound Name | bis[9-oxo-9-(trifluoromethoxy)nonyl] 9-[6-(dimethylamino)hexyl]heptadecanedioate |
|---|---|
| PubChem CID | 167543937 |
| Molecular Formula | C45H79F6NO8 |
| Molecular Weight | 876.11 g/mol |
| Exact Mass | 875.57 |
| IUPAC Name | bis[9-oxo-9-(trifluoromethoxy)nonyl] 9-[6-(dimethylamino)hexyl]heptadecanedioate |
| SMILES | CN(C)CCCCCCC(CCCCCCCC(=O)OCCCCCCCCC(=O)OC(F)(F)F)CCCCCCCC(=O)OCCCCCCCCC(=O)OC(F)(F)F |
| InChI | InChI=1S/C45H79F6NO8/c1-52(2)36-26-16-15-21-31-39(29-19-9-7-13-22-32-40(53)57-37-27-17-5-3-11-24-34-42(55)59-44(46,47)48)30-20-10-8-14-23-33-41(54)58-38-28-18-6-4-12-25-35-43(56)60-45(49,50)51/h39H,3-38H2,1-2H3 |
| InChIKey | WPQJAVXIQYZMSH-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.11 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|