C18H26BrNO4 — CID 157148760
ethyl (3S)-6-amino-3-(5-bromo-3-tert-butyl-2-hydroxyphenyl)-5-oxohexanoate (PubChem CID 157148760) has the molecular formula C18H26BrNO4 and a molecular weight of 400.31 g/mol. Its IUPAC name is ethyl (3S)-6-amino-3-(5-bromo-3-tert-butyl-2-hydroxyphenyl)-5-oxohexanoate.
| Compound Name | ethyl (3S)-6-amino-3-(5-bromo-3-tert-butyl-2-hydroxyphenyl)-5-oxohexanoate |
|---|---|
| PubChem CID | 157148760 |
| Molecular Formula | C18H26BrNO4 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | ethyl (3S)-6-amino-3-(5-bromo-3-tert-butyl-2-hydroxyphenyl)-5-oxohexanoate |
| SMILES | CCOC(=O)C[C@H](CC(=O)CN)c1cc(Br)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H26BrNO4/c1-5-24-16(22)7-11(6-13(21)10-20)14-8-12(19)9-15(17(14)23)18(2,3)4/h8-9,11,23H,5-7,10,20H2,1-4H3/t11-/m0/s1 |
| InChIKey | AKZYAIRPICRWOO-NSHDSACASA-N |
| XLogP | 3.41 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |